C16H13F3N4O2S2 — CID 135438647
2-[(6-oxo-4-propyl-1H-pyrimidin-2-yl)sulfanyl]-N-(4,5,6-trifluoro-1,3-benzothiazol-2-yl)acetamide (PubChem CID 135438647) has the molecular formula C16H13F3N4O2S2 and a molecular weight of 414.43 g/mol. Its IUPAC name is 2-[(6-oxo-4-propyl-1H-pyrimidin-2-yl)sulfanyl]-N-(4,5,6-trifluoro-1,3-benzothiazol-2-yl)acetamide.
| Compound Name | 2-[(6-oxo-4-propyl-1H-pyrimidin-2-yl)sulfanyl]-N-(4,5,6-trifluoro-1,3-benzothiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 135438647 |
| Molecular Formula | C16H13F3N4O2S2 |
| Molecular Weight | 414.43 g/mol |
| Exact Mass | 414.04 |
| IUPAC Name | 2-[(6-oxo-4-propyl-1H-pyrimidin-2-yl)sulfanyl]-N-(4,5,6-trifluoro-1,3-benzothiazol-2-yl)acetamide |
| SMILES | CCCc1cc(=O)[nH]c(SCC(=O)Nc2nc3c(F)c(F)c(F)cc3s2)n1 |
| InChI | InChI=1S/C16H13F3N4O2S2/c1-2-3-7-4-10(24)21-15(20-7)26-6-11(25)22-16-23-14-9(27-16)5-8(17)12(18)13(14)19/h4-5H,2-3,6H2,1H3,(H,20,21,24)(H,22,23,25) |
| InChIKey | AOFXQKSWBJNXNT-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.43 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|