C13H8N6O3 — CID 69090481
1,3-bis(2,1,3-benzoxadiazol-5-yl)urea (PubChem CID 69090481) has the molecular formula C13H8N6O3 and a molecular weight of 296.25 g/mol. Its IUPAC name is 1,3-bis(2,1,3-benzoxadiazol-5-yl)urea.
| Compound Name | 1,3-bis(2,1,3-benzoxadiazol-5-yl)urea |
|---|---|
| PubChem CID | 69090481 |
| Molecular Formula | C13H8N6O3 |
| Molecular Weight | 296.25 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 1,3-bis(2,1,3-benzoxadiazol-5-yl)urea |
| SMILES | O=C(Nc1ccc2nonc2c1)Nc1ccc2nonc2c1 |
| InChI | InChI=1S/C13H8N6O3/c20-13(14-7-1-3-9-11(5-7)18-21-16-9)15-8-2-4-10-12(6-8)19-22-17-10/h1-6H,(H2,14,15,20) |
| InChIKey | YEQKQMKLYNEQCY-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.25 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |