C19H28N2OSi2 — CID 591689
1,3-bis(4-trimethylsilylphenyl)urea (PubChem CID 591689) has the molecular formula C19H28N2OSi2 and a molecular weight of 356.62 g/mol. Its IUPAC name is 1,3-bis(4-trimethylsilylphenyl)urea.
| Compound Name | 1,3-bis(4-trimethylsilylphenyl)urea |
|---|---|
| PubChem CID | 591689 |
| Molecular Formula | C19H28N2OSi2 |
| Molecular Weight | 356.62 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 1,3-bis(4-trimethylsilylphenyl)urea |
| SMILES | C[Si](C)(C)c1ccc(NC(=O)Nc2ccc([Si](C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C19H28N2OSi2/c1-23(2,3)17-11-7-15(8-12-17)20-19(22)21-16-9-13-18(14-10-16)24(4,5)6/h7-14H,1-6H3,(H2,20,21,22) |
| InChIKey | OKANLSKYJQCMFV-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.62 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|