C12H20N2OSi — CID 15490432
1-(4-methylphenyl)-3-(trimethylsilylmethyl)urea (PubChem CID 15490432) has the molecular formula C12H20N2OSi and a molecular weight of 236.39 g/mol. Its IUPAC name is 1-(4-methylphenyl)-3-(trimethylsilylmethyl)urea.
| Compound Name | 1-(4-methylphenyl)-3-(trimethylsilylmethyl)urea |
|---|---|
| PubChem CID | 15490432 |
| Molecular Formula | C12H20N2OSi |
| Molecular Weight | 236.39 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 1-(4-methylphenyl)-3-(trimethylsilylmethyl)urea |
| SMILES | Cc1ccc(NC(=O)NC[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C12H20N2OSi/c1-10-5-7-11(8-6-10)14-12(15)13-9-16(2,3)4/h5-8H,9H2,1-4H3,(H2,13,14,15) |
| InChIKey | QXSQLOJHQLPKIM-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.39 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|