C13H16N4O+2 — CID 71396431
1,3-bis(1-methylpyridin-1-ium-4-yl)urea (PubChem CID 71396431) has the molecular formula C13H16N4O+2 and a molecular weight of 244.30 g/mol. Its IUPAC name is 1,3-bis(1-methylpyridin-1-ium-4-yl)urea.
| Compound Name | 1,3-bis(1-methylpyridin-1-ium-4-yl)urea |
|---|---|
| PubChem CID | 71396431 |
| Molecular Formula | C13H16N4O+2 |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 1,3-bis(1-methylpyridin-1-ium-4-yl)urea |
| SMILES | C[n+]1ccc(NC(=O)Nc2cc[n+](C)cc2)cc1 |
| InChI | InChI=1S/C13H14N4O/c1-16-7-3-11(4-8-16)14-13(18)15-12-5-9-17(2)10-6-12/h3-10H,1-2H3/p+2 |
| InChIKey | YIYSHDHTYRPJPW-UHFFFAOYSA-P |
| XLogP | 0.98 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|