C8H6ClN3O2 — CID 166432071
N-(2,1,3-benzoxadiazol-5-yl)-2-chloroacetamide (PubChem CID 166432071) has the molecular formula C8H6ClN3O2 and a molecular weight of 211.61 g/mol. Its IUPAC name is N-(2,1,3-benzoxadiazol-5-yl)-2-chloroacetamide.
| Compound Name | N-(2,1,3-benzoxadiazol-5-yl)-2-chloroacetamide |
|---|---|
| PubChem CID | 166432071 |
| Molecular Formula | C8H6ClN3O2 |
| Molecular Weight | 211.61 g/mol |
| Exact Mass | 211.01 |
| IUPAC Name | N-(2,1,3-benzoxadiazol-5-yl)-2-chloroacetamide |
| SMILES | O=C(CCl)Nc1ccc2nonc2c1 |
| InChI | InChI=1S/C8H6ClN3O2/c9-4-8(13)10-5-1-2-6-7(3-5)12-14-11-6/h1-3H,4H2,(H,10,13) |
| InChIKey | VMYYXBWPEVYFKC-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.61 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|