C15H15N5OS — CID 753189
1-(2,1,3-benzothiadiazol-5-yl)-3-[4-(dimethylamino)phenyl]urea (PubChem CID 753189) has the molecular formula C15H15N5OS and a molecular weight of 313.39 g/mol. Its IUPAC name is 1-(2,1,3-benzothiadiazol-5-yl)-3-[4-(dimethylamino)phenyl]urea.
| Compound Name | 1-(2,1,3-benzothiadiazol-5-yl)-3-[4-(dimethylamino)phenyl]urea |
|---|---|
| PubChem CID | 753189 |
| Molecular Formula | C15H15N5OS |
| Molecular Weight | 313.39 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 1-(2,1,3-benzothiadiazol-5-yl)-3-[4-(dimethylamino)phenyl]urea |
| SMILES | CN(C)c1ccc(NC(=O)Nc2ccc3nsnc3c2)cc1 |
| InChI | InChI=1S/C15H15N5OS/c1-20(2)12-6-3-10(4-7-12)16-15(21)17-11-5-8-13-14(9-11)19-22-18-13/h3-9H,1-2H3,(H2,16,17,21) |
| InChIKey | OSWPVYKQJWUTES-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.39 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|