C14H10Cl2F2N2O2 — CID 8002775
1-[3-chloro-4-(difluoromethoxy)phenyl]-3-(3-chlorophenyl)urea (PubChem CID 8002775) has the molecular formula C14H10Cl2F2N2O2 and a molecular weight of 347.15 g/mol. Its IUPAC name is 1-[3-chloro-4-(difluoromethoxy)phenyl]-3-(3-chlorophenyl)urea.
| Compound Name | 1-[3-chloro-4-(difluoromethoxy)phenyl]-3-(3-chlorophenyl)urea |
|---|---|
| PubChem CID | 8002775 |
| Molecular Formula | C14H10Cl2F2N2O2 |
| Molecular Weight | 347.15 g/mol |
| Exact Mass | 346.01 |
| IUPAC Name | 1-[3-chloro-4-(difluoromethoxy)phenyl]-3-(3-chlorophenyl)urea |
| SMILES | O=C(Nc1cccc(Cl)c1)Nc1ccc(OC(F)F)c(Cl)c1 |
| InChI | InChI=1S/C14H10Cl2F2N2O2/c15-8-2-1-3-9(6-8)19-14(21)20-10-4-5-12(11(16)7-10)22-13(17)18/h1-7,13H,(H2,19,20,21) |
| InChIKey | WIFAAKGHHNVGHI-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.15 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |