C27H23NO10 — CID 163128837
3-[3-(3,4-dimethoxyphenyl)-2-ethoxycarbonyl-4-oxochromen-7-yl]oxycarbonyl-N-hydroxybenzeneamine oxide (PubChem CID 163128837) has the molecular formula C27H23NO10 and a molecular weight of 521.48 g/mol. Its IUPAC name is 3-[3-(3,4-dimethoxyphenyl)-2-ethoxycarbonyl-4-oxochromen-7-yl]oxycarbonyl-N-hydroxybenzeneamine oxide.
| Compound Name | 3-[3-(3,4-dimethoxyphenyl)-2-ethoxycarbonyl-4-oxochromen-7-yl]oxycarbonyl-N-hydroxybenzeneamine oxide |
|---|---|
| PubChem CID | 163128837 |
| Molecular Formula | C27H23NO10 |
| Molecular Weight | 521.48 g/mol |
| Exact Mass | 521.13 |
| IUPAC Name | 3-[3-(3,4-dimethoxyphenyl)-2-ethoxycarbonyl-4-oxochromen-7-yl]oxycarbonyl-N-hydroxybenzeneamine oxide |
| SMILES | CCOC(=O)c1oc2cc(OC(=O)c3cccc([NH+]([O-])O)c3)ccc2c(=O)c1-c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C27H23NO10/c1-4-36-27(31)25-23(15-8-11-20(34-2)22(13-15)35-3)24(29)19-10-9-18(14-21(19)38-25)37-26(30)16-6-5-7-17(12-16)28(32)33/h5-14,28,32H,4H2,1-3H3 |
| InChIKey | FISMMCLHBRZLED-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 149.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.48 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|