C28H30O8 — CID 4630206
ethyl 7-(3-cyclopentylpropanoyloxy)-3-(3,4-dimethoxyphenyl)-4-oxochromene-2-carboxylate (PubChem CID 4630206) has the molecular formula C28H30O8 and a molecular weight of 494.54 g/mol. Its IUPAC name is ethyl 7-(3-cyclopentylpropanoyloxy)-3-(3,4-dimethoxyphenyl)-4-oxochromene-2-carboxylate.
| Compound Name | ethyl 7-(3-cyclopentylpropanoyloxy)-3-(3,4-dimethoxyphenyl)-4-oxochromene-2-carboxylate |
|---|---|
| PubChem CID | 4630206 |
| Molecular Formula | C28H30O8 |
| Molecular Weight | 494.54 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | ethyl 7-(3-cyclopentylpropanoyloxy)-3-(3,4-dimethoxyphenyl)-4-oxochromene-2-carboxylate |
| SMILES | CCOC(=O)c1oc2cc(OC(=O)CCC3CCCC3)ccc2c(=O)c1-c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C28H30O8/c1-4-34-28(31)27-25(18-10-13-21(32-2)23(15-18)33-3)26(30)20-12-11-19(16-22(20)36-27)35-24(29)14-9-17-7-5-6-8-17/h10-13,15-17H,4-9,14H2,1-3H3 |
| InChIKey | GFOMQAQEVPKQAO-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 101.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.54 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|