C22H23NO6 — CID 141276513
(2,5-dimethoxyphenyl)-[5-hydroxy-4-(4-methylmorpholin-3-yl)-1-benzofuran-3-yl]methanone (PubChem CID 141276513) has the molecular formula C22H23NO6 and a molecular weight of 397.43 g/mol. Its IUPAC name is (2,5-dimethoxyphenyl)-[5-hydroxy-4-(4-methylmorpholin-3-yl)-1-benzofuran-3-yl]methanone.
| Compound Name | (2,5-dimethoxyphenyl)-[5-hydroxy-4-(4-methylmorpholin-3-yl)-1-benzofuran-3-yl]methanone |
|---|---|
| PubChem CID | 141276513 |
| Molecular Formula | C22H23NO6 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | (2,5-dimethoxyphenyl)-[5-hydroxy-4-(4-methylmorpholin-3-yl)-1-benzofuran-3-yl]methanone |
| SMILES | COc1ccc(OC)c(C(=O)c2coc3ccc(O)c(C4COCCN4C)c23)c1 |
| InChI | InChI=1S/C22H23NO6/c1-23-8-9-28-12-16(23)21-17(24)5-7-19-20(21)15(11-29-19)22(25)14-10-13(26-2)4-6-18(14)27-3/h4-7,10-11,16,24H,8-9,12H2,1-3H3 |
| InChIKey | TZUZXJBSLUPRIM-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 81.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|