C21H21NO4 — CID 127255296
[5-hydroxy-4-(pyrrolidin-1-ylmethyl)-1-benzofuran-3-yl]-(3-methoxyphenyl)methanone (PubChem CID 127255296) has the molecular formula C21H21NO4 and a molecular weight of 351.40 g/mol. Its IUPAC name is [5-hydroxy-4-(pyrrolidin-1-ylmethyl)-1-benzofuran-3-yl]-(3-methoxyphenyl)methanone.
| Compound Name | [5-hydroxy-4-(pyrrolidin-1-ylmethyl)-1-benzofuran-3-yl]-(3-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 127255296 |
| Molecular Formula | C21H21NO4 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | [5-hydroxy-4-(pyrrolidin-1-ylmethyl)-1-benzofuran-3-yl]-(3-methoxyphenyl)methanone |
| SMILES | COc1cccc(C(=O)c2coc3ccc(O)c(CN4CCCC4)c23)c1 |
| InChI | InChI=1S/C21H21NO4/c1-25-15-6-4-5-14(11-15)21(24)17-13-26-19-8-7-18(23)16(20(17)19)12-22-9-2-3-10-22/h4-8,11,13,23H,2-3,9-10,12H2,1H3 |
| InChIKey | OSXMSUVNDMPUID-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|