C23H19NO4 — CID 99997912
[4-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-5-hydroxy-1-benzofuran-3-yl]-(furan-2-yl)methanone (PubChem CID 99997912) has the molecular formula C23H19NO4 and a molecular weight of 373.41 g/mol. Its IUPAC name is [4-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-5-hydroxy-1-benzofuran-3-yl]-(furan-2-yl)methanone.
| Compound Name | [4-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-5-hydroxy-1-benzofuran-3-yl]-(furan-2-yl)methanone |
|---|---|
| PubChem CID | 99997912 |
| Molecular Formula | C23H19NO4 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | [4-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-5-hydroxy-1-benzofuran-3-yl]-(furan-2-yl)methanone |
| SMILES | O=C(c1ccco1)c1coc2ccc(O)c(CN3CCc4ccccc4C3)c12 |
| InChI | InChI=1S/C23H19NO4/c25-19-7-8-20-22(18(14-28-20)23(26)21-6-3-11-27-21)17(19)13-24-10-9-15-4-1-2-5-16(15)12-24/h1-8,11,14,25H,9-10,12-13H2 |
| InChIKey | XIUAHAFEHGNAJR-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 66.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|