C25H30N2O4 — CID 7540219
N-(2,6-diethylphenyl)-5-hydroxy-2-methyl-4-(morpholin-4-ylmethyl)-1-benzofuran-3-carboxamide (PubChem CID 7540219) has the molecular formula C25H30N2O4 and a molecular weight of 422.53 g/mol. Its IUPAC name is N-(2,6-diethylphenyl)-5-hydroxy-2-methyl-4-(morpholin-4-ylmethyl)-1-benzofuran-3-carboxamide.
| Compound Name | N-(2,6-diethylphenyl)-5-hydroxy-2-methyl-4-(morpholin-4-ylmethyl)-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 7540219 |
| Molecular Formula | C25H30N2O4 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | N-(2,6-diethylphenyl)-5-hydroxy-2-methyl-4-(morpholin-4-ylmethyl)-1-benzofuran-3-carboxamide |
| SMILES | CCc1cccc(CC)c1NC(=O)c1c(C)oc2ccc(O)c(CN3CCOCC3)c12 |
| InChI | InChI=1S/C25H30N2O4/c1-4-17-7-6-8-18(5-2)24(17)26-25(29)22-16(3)31-21-10-9-20(28)19(23(21)22)15-27-11-13-30-14-12-27/h6-10,28H,4-5,11-15H2,1-3H3,(H,26,29) |
| InChIKey | ULPDRRBMLLBVBD-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 74.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|