C22H25N2O4+ — CID 7540213
5-hydroxy-2-methyl-N-(4-methylphenyl)-4-(morpholin-4-ium-4-ylmethyl)-1-benzofuran-3-carboxamide (PubChem CID 7540213) has the molecular formula C22H25N2O4+ and a molecular weight of 381.45 g/mol. Its IUPAC name is 5-hydroxy-2-methyl-N-(4-methylphenyl)-4-(morpholin-4-ium-4-ylmethyl)-1-benzofuran-3-carboxamide.
| Compound Name | 5-hydroxy-2-methyl-N-(4-methylphenyl)-4-(morpholin-4-ium-4-ylmethyl)-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 7540213 |
| Molecular Formula | C22H25N2O4+ |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | 5-hydroxy-2-methyl-N-(4-methylphenyl)-4-(morpholin-4-ium-4-ylmethyl)-1-benzofuran-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2c(C)oc3ccc(O)c(C[NH+]4CCOCC4)c23)cc1 |
| InChI | InChI=1S/C22H24N2O4/c1-14-3-5-16(6-4-14)23-22(26)20-15(2)28-19-8-7-18(25)17(21(19)20)13-24-9-11-27-12-10-24/h3-8,25H,9-13H2,1-2H3,(H,23,26)/p+1 |
| InChIKey | OJGIPEYIYDWOGZ-UHFFFAOYSA-O |
| XLogP | 2.42 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|