C19H14F3NO4 — CID 134214596
5-hydroxy-2-methyl-4-(2-oxoethyl)-N-[4-(trifluoromethyl)phenyl]-1-benzofuran-3-carboxamide (PubChem CID 134214596) has the molecular formula C19H14F3NO4 and a molecular weight of 377.32 g/mol. Its IUPAC name is 5-hydroxy-2-methyl-4-(2-oxoethyl)-N-[4-(trifluoromethyl)phenyl]-1-benzofuran-3-carboxamide.
| Compound Name | 5-hydroxy-2-methyl-4-(2-oxoethyl)-N-[4-(trifluoromethyl)phenyl]-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 134214596 |
| Molecular Formula | C19H14F3NO4 |
| Molecular Weight | 377.32 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | 5-hydroxy-2-methyl-4-(2-oxoethyl)-N-[4-(trifluoromethyl)phenyl]-1-benzofuran-3-carboxamide |
| SMILES | Cc1oc2ccc(O)c(CC=O)c2c1C(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H14F3NO4/c1-10-16(17-13(8-9-24)14(25)6-7-15(17)27-10)18(26)23-12-4-2-11(3-5-12)19(20,21)22/h2-7,9,25H,8H2,1H3,(H,23,26) |
| InChIKey | GSSPMUOSUGREHL-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.32 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|