C17H14O4 — CID 134588362
4-ethyl-5-hydroxy-2-phenyl-1-benzofuran-3-carboxylic acid (PubChem CID 134588362) has the molecular formula C17H14O4 and a molecular weight of 282.29 g/mol. Its IUPAC name is 4-ethyl-5-hydroxy-2-phenyl-1-benzofuran-3-carboxylic acid.
| Compound Name | 4-ethyl-5-hydroxy-2-phenyl-1-benzofuran-3-carboxylic acid |
|---|---|
| PubChem CID | 134588362 |
| Molecular Formula | C17H14O4 |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 4-ethyl-5-hydroxy-2-phenyl-1-benzofuran-3-carboxylic acid |
| SMILES | CCc1c(O)ccc2oc(-c3ccccc3)c(C(=O)O)c12 |
| InChI | InChI=1S/C17H14O4/c1-2-11-12(18)8-9-13-14(11)15(17(19)20)16(21-13)10-6-4-3-5-7-10/h3-9,18H,2H2,1H3,(H,19,20) |
| InChIKey | SENFQBCIOIFYAL-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |