C17H10O6 — CID 70037924
4-oxo-2-phenylchromene-3,5-dicarboxylic acid (PubChem CID 70037924) has the molecular formula C17H10O6 and a molecular weight of 310.26 g/mol. Its IUPAC name is 4-oxo-2-phenylchromene-3,5-dicarboxylic acid.
| Compound Name | 4-oxo-2-phenylchromene-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 70037924 |
| Molecular Formula | C17H10O6 |
| Molecular Weight | 310.26 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | 4-oxo-2-phenylchromene-3,5-dicarboxylic acid |
| SMILES | O=C(O)c1c(-c2ccccc2)oc2cccc(C(=O)O)c2c1=O |
| InChI | InChI=1S/C17H10O6/c18-14-12-10(16(19)20)7-4-8-11(12)23-15(13(14)17(21)22)9-5-2-1-3-6-9/h1-8H,(H,19,20)(H,21,22) |
| InChIKey | VJLFQOBRARFAHR-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.26 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |