C29H31N3O3 — CID 164520764
5-hydroxy-2-(4-methoxyphenyl)-N-methyl-1-phenyl-4-(piperidin-1-ylmethyl)indole-3-carboxamide (PubChem CID 164520764) has the molecular formula C29H31N3O3 and a molecular weight of 469.59 g/mol. Its IUPAC name is 5-hydroxy-2-(4-methoxyphenyl)-N-methyl-1-phenyl-4-(piperidin-1-ylmethyl)indole-3-carboxamide.
| Compound Name | 5-hydroxy-2-(4-methoxyphenyl)-N-methyl-1-phenyl-4-(piperidin-1-ylmethyl)indole-3-carboxamide |
|---|---|
| PubChem CID | 164520764 |
| Molecular Formula | C29H31N3O3 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.24 |
| IUPAC Name | 5-hydroxy-2-(4-methoxyphenyl)-N-methyl-1-phenyl-4-(piperidin-1-ylmethyl)indole-3-carboxamide |
| SMILES | CNC(=O)c1c(-c2ccc(OC)cc2)n(-c2ccccc2)c2ccc(O)c(CN3CCCCC3)c12 |
| InChI | InChI=1S/C29H31N3O3/c1-30-29(34)27-26-23(19-31-17-7-4-8-18-31)25(33)16-15-24(26)32(21-9-5-3-6-10-21)28(27)20-11-13-22(35-2)14-12-20/h3,5-6,9-16,33H,4,7-8,17-19H2,1-2H3,(H,30,34) |
| InChIKey | BXFGTMBLQFPLEH-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|