C28H37N3O2 — CID 14625881
1-hexyl-5-hydroxy-2-methyl-N-phenyl-4-(piperidin-1-ylmethyl)indole-3-carboxamide (PubChem CID 14625881) has the molecular formula C28H37N3O2 and a molecular weight of 447.62 g/mol. Its IUPAC name is 1-hexyl-5-hydroxy-2-methyl-N-phenyl-4-(piperidin-1-ylmethyl)indole-3-carboxamide.
| Compound Name | 1-hexyl-5-hydroxy-2-methyl-N-phenyl-4-(piperidin-1-ylmethyl)indole-3-carboxamide |
|---|---|
| PubChem CID | 14625881 |
| Molecular Formula | C28H37N3O2 |
| Molecular Weight | 447.62 g/mol |
| Exact Mass | 447.29 |
| IUPAC Name | 1-hexyl-5-hydroxy-2-methyl-N-phenyl-4-(piperidin-1-ylmethyl)indole-3-carboxamide |
| SMILES | CCCCCCn1c(C)c(C(=O)Nc2ccccc2)c2c(CN3CCCCC3)c(O)ccc21 |
| InChI | InChI=1S/C28H37N3O2/c1-3-4-5-12-19-31-21(2)26(28(33)29-22-13-8-6-9-14-22)27-23(25(32)16-15-24(27)31)20-30-17-10-7-11-18-30/h6,8-9,13-16,32H,3-5,7,10-12,17-20H2,1-2H3,(H,29,33) |
| InChIKey | KWJZHSXUZWXHLQ-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 57.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.62 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|