C31H51N3O2 — CID 19844554
1-hexyl-5-hydroxy-N,2-dimethyl-N-octyl-4-(piperidin-1-ylmethyl)indole-3-carboxamide (PubChem CID 19844554) has the molecular formula C31H51N3O2 and a molecular weight of 497.77 g/mol. Its IUPAC name is 1-hexyl-5-hydroxy-N,2-dimethyl-N-octyl-4-(piperidin-1-ylmethyl)indole-3-carboxamide.
| Compound Name | 1-hexyl-5-hydroxy-N,2-dimethyl-N-octyl-4-(piperidin-1-ylmethyl)indole-3-carboxamide |
|---|---|
| PubChem CID | 19844554 |
| Molecular Formula | C31H51N3O2 |
| Molecular Weight | 497.77 g/mol |
| Exact Mass | 497.40 |
| IUPAC Name | 1-hexyl-5-hydroxy-N,2-dimethyl-N-octyl-4-(piperidin-1-ylmethyl)indole-3-carboxamide |
| SMILES | CCCCCCCCN(C)C(=O)c1c(C)n(CCCCCC)c2ccc(O)c(CN3CCCCC3)c12 |
| InChI | InChI=1S/C31H51N3O2/c1-5-7-9-11-12-14-20-32(4)31(36)29-25(3)34(23-17-10-8-6-2)27-18-19-28(35)26(30(27)29)24-33-21-15-13-16-22-33/h18-19,35H,5-17,20-24H2,1-4H3 |
| InChIKey | MOFUYZBIHZQEFY-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.77 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|