C31H43N3O2 — CID 19844544
1-benzyl-5-hydroxy-2-methyl-N-octyl-4-(piperidin-1-ylmethyl)indole-3-carboxamide (PubChem CID 19844544) has the molecular formula C31H43N3O2 and a molecular weight of 489.70 g/mol. Its IUPAC name is 1-benzyl-5-hydroxy-2-methyl-N-octyl-4-(piperidin-1-ylmethyl)indole-3-carboxamide.
| Compound Name | 1-benzyl-5-hydroxy-2-methyl-N-octyl-4-(piperidin-1-ylmethyl)indole-3-carboxamide |
|---|---|
| PubChem CID | 19844544 |
| Molecular Formula | C31H43N3O2 |
| Molecular Weight | 489.70 g/mol |
| Exact Mass | 489.34 |
| IUPAC Name | 1-benzyl-5-hydroxy-2-methyl-N-octyl-4-(piperidin-1-ylmethyl)indole-3-carboxamide |
| SMILES | CCCCCCCCNC(=O)c1c(C)n(Cc2ccccc2)c2ccc(O)c(CN3CCCCC3)c12 |
| InChI | InChI=1S/C31H43N3O2/c1-3-4-5-6-7-12-19-32-31(36)29-24(2)34(22-25-15-10-8-11-16-25)27-17-18-28(35)26(30(27)29)23-33-20-13-9-14-21-33/h8,10-11,15-18,35H,3-7,9,12-14,19-23H2,1-2H3,(H,32,36) |
| InChIKey | LXRSYTMPDUBHSN-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 57.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.70 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|