C33H38ClN3O3 — CID 19844547
5-hydroxy-2-methyl-1-phenyl-N-(2-phenylethyl)-4-(piperidin-1-ylmethyl)-6-propanoylindole-3-carboxamide;hydrochloride (PubChem CID 19844547) has the molecular formula C33H38ClN3O3 and a molecular weight of 560.14 g/mol. Its IUPAC name is 5-hydroxy-2-methyl-1-phenyl-N-(2-phenylethyl)-4-(piperidin-1-ylmethyl)-6-propanoylindole-3-carboxamide;hydrochloride.
| Compound Name | 5-hydroxy-2-methyl-1-phenyl-N-(2-phenylethyl)-4-(piperidin-1-ylmethyl)-6-propanoylindole-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 19844547 |
| Molecular Formula | C33H38ClN3O3 |
| Molecular Weight | 560.14 g/mol |
| Exact Mass | 559.26 |
| IUPAC Name | 5-hydroxy-2-methyl-1-phenyl-N-(2-phenylethyl)-4-(piperidin-1-ylmethyl)-6-propanoylindole-3-carboxamide;hydrochloride |
| SMILES | CCC(=O)c1cc2c(c(CN3CCCCC3)c1O)c(C(=O)NCCc1ccccc1)c(C)n2-c1ccccc1.Cl |
| InChI | InChI=1S/C33H37N3O3.ClH/c1-3-29(37)26-21-28-31(27(32(26)38)22-35-19-11-6-12-20-35)30(23(2)36(28)25-15-9-5-10-16-25)33(39)34-18-17-24-13-7-4-8-14-24;/h4-5,7-10,13-16,21,38H,3,6,11-12,17-20,22H2,1-2H3,(H,34,39);1H |
| InChIKey | NGLIRPUBKFHIMH-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 74.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.14 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|