C24H27N3O3 — CID 91074763
2,4-dihydroxy-N-(2-phenylethyl)-1-(4-piperidin-1-ylphenyl)pyrrole-3-carboxamide (PubChem CID 91074763) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is 2,4-dihydroxy-N-(2-phenylethyl)-1-(4-piperidin-1-ylphenyl)pyrrole-3-carboxamide.
| Compound Name | 2,4-dihydroxy-N-(2-phenylethyl)-1-(4-piperidin-1-ylphenyl)pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 91074763 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | 2,4-dihydroxy-N-(2-phenylethyl)-1-(4-piperidin-1-ylphenyl)pyrrole-3-carboxamide |
| SMILES | O=C(NCCc1ccccc1)c1c(O)cn(-c2ccc(N3CCCCC3)cc2)c1O |
| InChI | InChI=1S/C24H27N3O3/c28-21-17-27(20-11-9-19(10-12-20)26-15-5-2-6-16-26)24(30)22(21)23(29)25-14-13-18-7-3-1-4-8-18/h1,3-4,7-12,17,28,30H,2,5-6,13-16H2,(H,25,29) |
| InChIKey | IBKGKHXCKATOSC-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 77.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|