C27H41N3O3 — CID 14625866
N,1-dibutyl-5-hydroxy-2-methyl-4-(piperidin-1-ylmethyl)-6-propanoylindole-3-carboxamide (PubChem CID 14625866) has the molecular formula C27H41N3O3 and a molecular weight of 455.64 g/mol. Its IUPAC name is N,1-dibutyl-5-hydroxy-2-methyl-4-(piperidin-1-ylmethyl)-6-propanoylindole-3-carboxamide.
| Compound Name | N,1-dibutyl-5-hydroxy-2-methyl-4-(piperidin-1-ylmethyl)-6-propanoylindole-3-carboxamide |
|---|---|
| PubChem CID | 14625866 |
| Molecular Formula | C27H41N3O3 |
| Molecular Weight | 455.64 g/mol |
| Exact Mass | 455.31 |
| IUPAC Name | N,1-dibutyl-5-hydroxy-2-methyl-4-(piperidin-1-ylmethyl)-6-propanoylindole-3-carboxamide |
| SMILES | CCCCNC(=O)c1c(C)n(CCCC)c2cc(C(=O)CC)c(O)c(CN3CCCCC3)c12 |
| InChI | InChI=1S/C27H41N3O3/c1-5-8-13-28-27(33)24-19(4)30(16-9-6-2)22-17-20(23(31)7-3)26(32)21(25(22)24)18-29-14-11-10-12-15-29/h17,32H,5-16,18H2,1-4H3,(H,28,33) |
| InChIKey | LPSDKJIIEAAPFR-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 74.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.64 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|