C27H34N2O2 — CID 164520755
1-[1-(4-tert-butylphenyl)-5-hydroxy-2-methyl-4-(piperidin-1-ylmethyl)indol-3-yl]ethanone (PubChem CID 164520755) has the molecular formula C27H34N2O2 and a molecular weight of 418.58 g/mol. Its IUPAC name is 1-[1-(4-tert-butylphenyl)-5-hydroxy-2-methyl-4-(piperidin-1-ylmethyl)indol-3-yl]ethanone.
| Compound Name | 1-[1-(4-tert-butylphenyl)-5-hydroxy-2-methyl-4-(piperidin-1-ylmethyl)indol-3-yl]ethanone |
|---|---|
| PubChem CID | 164520755 |
| Molecular Formula | C27H34N2O2 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.26 |
| IUPAC Name | 1-[1-(4-tert-butylphenyl)-5-hydroxy-2-methyl-4-(piperidin-1-ylmethyl)indol-3-yl]ethanone |
| SMILES | CC(=O)c1c(C)n(-c2ccc(C(C)(C)C)cc2)c2ccc(O)c(CN3CCCCC3)c12 |
| InChI | InChI=1S/C27H34N2O2/c1-18-25(19(2)30)26-22(17-28-15-7-6-8-16-28)24(31)14-13-23(26)29(18)21-11-9-20(10-12-21)27(3,4)5/h9-14,31H,6-8,15-17H2,1-5H3 |
| InChIKey | URXWOVBDNCIMSH-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|