C23H29ClN4O2 — CID 52997411
3-[(4-methoxyphenyl)diazenyl]-1,2-dimethyl-4-(piperidin-1-ylmethyl)indol-5-ol;hydrochloride (PubChem CID 52997411) has the molecular formula C23H29ClN4O2 and a molecular weight of 428.96 g/mol. Its IUPAC name is 3-[(4-methoxyphenyl)diazenyl]-1,2-dimethyl-4-(piperidin-1-ylmethyl)indol-5-ol;hydrochloride.
| Compound Name | 3-[(4-methoxyphenyl)diazenyl]-1,2-dimethyl-4-(piperidin-1-ylmethyl)indol-5-ol;hydrochloride |
|---|---|
| PubChem CID | 52997411 |
| Molecular Formula | C23H29ClN4O2 |
| Molecular Weight | 428.96 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | 3-[(4-methoxyphenyl)diazenyl]-1,2-dimethyl-4-(piperidin-1-ylmethyl)indol-5-ol;hydrochloride |
| SMILES | COc1ccc(/N=N/c2c(C)n(C)c3ccc(O)c(CN4CCCCC4)c23)cc1.Cl |
| InChI | InChI=1S/C23H28N4O2.ClH/c1-16-23(25-24-17-7-9-18(29-3)10-8-17)22-19(15-27-13-5-4-6-14-27)21(28)12-11-20(22)26(16)2;/h7-12,28H,4-6,13-15H2,1-3H3;1H/b25-24+; |
| InChIKey | DNSGKCRCTKUMCL-QREUMGABSA-N |
| XLogP | 6.02 |
| TPSA | 62.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.96 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|