C25H19N3O8 — CID 5085968
ethyl 5-(2,4-dinitrobenzoyl)oxy-2-methyl-1-phenylindole-3-carboxylate (PubChem CID 5085968) has the molecular formula C25H19N3O8 and a molecular weight of 489.44 g/mol. Its IUPAC name is ethyl 5-(2,4-dinitrobenzoyl)oxy-2-methyl-1-phenylindole-3-carboxylate.
| Compound Name | ethyl 5-(2,4-dinitrobenzoyl)oxy-2-methyl-1-phenylindole-3-carboxylate |
|---|---|
| PubChem CID | 5085968 |
| Molecular Formula | C25H19N3O8 |
| Molecular Weight | 489.44 g/mol |
| Exact Mass | 489.12 |
| IUPAC Name | ethyl 5-(2,4-dinitrobenzoyl)oxy-2-methyl-1-phenylindole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)n(-c2ccccc2)c2ccc(OC(=O)c3ccc([N+](=O)[O-])cc3[N+](=O)[O-])cc12 |
| InChI | InChI=1S/C25H19N3O8/c1-3-35-25(30)23-15(2)26(16-7-5-4-6-8-16)21-12-10-18(14-20(21)23)36-24(29)19-11-9-17(27(31)32)13-22(19)28(33)34/h4-14H,3H2,1-2H3 |
| InChIKey | JVKKJEROJZKEGQ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 143.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.44 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|