C32H24ClFN2O5 — CID 23995006
ethyl 5-[2-[(2-chloro-6-fluorobenzoyl)amino]benzoyl]oxy-2-methyl-1-phenylindole-3-carboxylate (PubChem CID 23995006) has the molecular formula C32H24ClFN2O5 and a molecular weight of 571.00 g/mol. Its IUPAC name is ethyl 5-[2-[(2-chloro-6-fluorobenzoyl)amino]benzoyl]oxy-2-methyl-1-phenylindole-3-carboxylate.
| Compound Name | ethyl 5-[2-[(2-chloro-6-fluorobenzoyl)amino]benzoyl]oxy-2-methyl-1-phenylindole-3-carboxylate |
|---|---|
| PubChem CID | 23995006 |
| Molecular Formula | C32H24ClFN2O5 |
| Molecular Weight | 571.00 g/mol |
| Exact Mass | 570.14 |
| IUPAC Name | ethyl 5-[2-[(2-chloro-6-fluorobenzoyl)amino]benzoyl]oxy-2-methyl-1-phenylindole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)n(-c2ccccc2)c2ccc(OC(=O)c3ccccc3NC(=O)c3c(F)cccc3Cl)cc12 |
| InChI | InChI=1S/C32H24ClFN2O5/c1-3-40-32(39)28-19(2)36(20-10-5-4-6-11-20)27-17-16-21(18-23(27)28)41-31(38)22-12-7-8-15-26(22)35-30(37)29-24(33)13-9-14-25(29)34/h4-18H,3H2,1-2H3,(H,35,37) |
| InChIKey | XZQFEPDAHLCKCT-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.00 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|