C28H28N4O5 — CID 2180555
ethyl 5-(6-cyclohexyl-5-nitropyrimidin-4-yl)oxy-2-methyl-1-phenylindole-3-carboxylate (PubChem CID 2180555) has the molecular formula C28H28N4O5 and a molecular weight of 500.56 g/mol. Its IUPAC name is ethyl 5-(6-cyclohexyl-5-nitropyrimidin-4-yl)oxy-2-methyl-1-phenylindole-3-carboxylate.
| Compound Name | ethyl 5-(6-cyclohexyl-5-nitropyrimidin-4-yl)oxy-2-methyl-1-phenylindole-3-carboxylate |
|---|---|
| PubChem CID | 2180555 |
| Molecular Formula | C28H28N4O5 |
| Molecular Weight | 500.56 g/mol |
| Exact Mass | 500.21 |
| IUPAC Name | ethyl 5-(6-cyclohexyl-5-nitropyrimidin-4-yl)oxy-2-methyl-1-phenylindole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)n(-c2ccccc2)c2ccc(Oc3ncnc(C4CCCCC4)c3[N+](=O)[O-])cc12 |
| InChI | InChI=1S/C28H28N4O5/c1-3-36-28(33)24-18(2)31(20-12-8-5-9-13-20)23-15-14-21(16-22(23)24)37-27-26(32(34)35)25(29-17-30-27)19-10-6-4-7-11-19/h5,8-9,12-17,19H,3-4,6-7,10-11H2,1-2H3 |
| InChIKey | ZUNNZLXPFAARIC-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 109.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.56 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|