C22H25N5O7 — CID 14870912
ethyl 5-(6-methoxy-5-nitropyrimidin-4-yl)oxy-1-methyl-2-(morpholin-4-ylmethyl)indole-3-carboxylate (PubChem CID 14870912) has the molecular formula C22H25N5O7 and a molecular weight of 471.47 g/mol. Its IUPAC name is ethyl 5-(6-methoxy-5-nitropyrimidin-4-yl)oxy-1-methyl-2-(morpholin-4-ylmethyl)indole-3-carboxylate.
| Compound Name | ethyl 5-(6-methoxy-5-nitropyrimidin-4-yl)oxy-1-methyl-2-(morpholin-4-ylmethyl)indole-3-carboxylate |
|---|---|
| PubChem CID | 14870912 |
| Molecular Formula | C22H25N5O7 |
| Molecular Weight | 471.47 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | ethyl 5-(6-methoxy-5-nitropyrimidin-4-yl)oxy-1-methyl-2-(morpholin-4-ylmethyl)indole-3-carboxylate |
| SMILES | CCOC(=O)c1c(CN2CCOCC2)n(C)c2ccc(Oc3ncnc(OC)c3[N+](=O)[O-])cc12 |
| InChI | InChI=1S/C22H25N5O7/c1-4-33-22(28)18-15-11-14(34-21-19(27(29)30)20(31-3)23-13-24-21)5-6-16(15)25(2)17(18)12-26-7-9-32-10-8-26/h5-6,11,13H,4,7-10,12H2,1-3H3 |
| InChIKey | YVTGCAAUCNHPMK-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 131.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.47 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|