C14H10Br2O2 — CID 159921662
3,7-dibromo-2-methoxy-8-methyldibenzofuran (PubChem CID 159921662) has the molecular formula C14H10Br2O2 and a molecular weight of 370.04 g/mol. Its IUPAC name is 3,7-dibromo-2-methoxy-8-methyldibenzofuran.
| Compound Name | 3,7-dibromo-2-methoxy-8-methyldibenzofuran |
|---|---|
| PubChem CID | 159921662 |
| Molecular Formula | C14H10Br2O2 |
| Molecular Weight | 370.04 g/mol |
| Exact Mass | 367.90 |
| IUPAC Name | 3,7-dibromo-2-methoxy-8-methyldibenzofuran |
| SMILES | COc1cc2c(cc1Br)oc1cc(Br)c(C)cc12 |
| InChI | InChI=1S/C14H10Br2O2/c1-7-3-8-9-4-14(17-2)11(16)6-13(9)18-12(8)5-10(7)15/h3-6H,1-2H3 |
| InChIKey | YVOQTNAGWUHCME-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 22.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.04 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |