C16H10FN2O7S- — CID 7728362
5-[(4-fluoro-3-nitrophenyl)sulfonylamino]-2-methyl-1-benzofuran-3-carboxylate (PubChem CID 7728362) has the molecular formula C16H10FN2O7S- and a molecular weight of 393.33 g/mol. Its IUPAC name is 5-[(4-fluoro-3-nitrophenyl)sulfonylamino]-2-methyl-1-benzofuran-3-carboxylate.
| Compound Name | 5-[(4-fluoro-3-nitrophenyl)sulfonylamino]-2-methyl-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 7728362 |
| Molecular Formula | C16H10FN2O7S- |
| Molecular Weight | 393.33 g/mol |
| Exact Mass | 393.02 |
| IUPAC Name | 5-[(4-fluoro-3-nitrophenyl)sulfonylamino]-2-methyl-1-benzofuran-3-carboxylate |
| SMILES | Cc1oc2ccc(NS(=O)(=O)c3ccc(F)c([N+](=O)[O-])c3)cc2c1C(=O)[O-] |
| InChI | InChI=1S/C16H11FN2O7S/c1-8-15(16(20)21)11-6-9(2-5-14(11)26-8)18-27(24,25)10-3-4-12(17)13(7-10)19(22)23/h2-7,18H,1H3,(H,20,21)/p-1 |
| InChIKey | RFFBMERBKYPMQA-UHFFFAOYSA-M |
| XLogP | 1.95 |
| TPSA | 142.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.33 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|