C22H22Cl3NO3S — CID 25043002
N-(8-tert-butyl-6,7,8,9-tetrahydrodibenzofuran-2-yl)-2,4,5-trichlorobenzenesulfonamide (PubChem CID 25043002) has the molecular formula C22H22Cl3NO3S and a molecular weight of 486.85 g/mol. Its IUPAC name is N-(8-tert-butyl-6,7,8,9-tetrahydrodibenzofuran-2-yl)-2,4,5-trichlorobenzenesulfonamide.
| Compound Name | N-(8-tert-butyl-6,7,8,9-tetrahydrodibenzofuran-2-yl)-2,4,5-trichlorobenzenesulfonamide |
|---|---|
| PubChem CID | 25043002 |
| Molecular Formula | C22H22Cl3NO3S |
| Molecular Weight | 486.85 g/mol |
| Exact Mass | 485.04 |
| IUPAC Name | N-(8-tert-butyl-6,7,8,9-tetrahydrodibenzofuran-2-yl)-2,4,5-trichlorobenzenesulfonamide |
| SMILES | CC(C)(C)C1CCc2oc3ccc(NS(=O)(=O)c4cc(Cl)c(Cl)cc4Cl)cc3c2C1 |
| InChI | InChI=1S/C22H22Cl3NO3S/c1-22(2,3)12-4-6-19-14(8-12)15-9-13(5-7-20(15)29-19)26-30(27,28)21-11-17(24)16(23)10-18(21)25/h5,7,9-12,26H,4,6,8H2,1-3H3 |
| InChIKey | AEESIDSZYPVMHY-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.85 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|