C23H18Cl3NO3S — CID 25035364
2,4,5-trichloro-N-(8-methyl-7,8,9,10-tetrahydronaphtho[1,2-b][1]benzofuran-5-yl)benzenesulfonamide (PubChem CID 25035364) has the molecular formula C23H18Cl3NO3S and a molecular weight of 494.83 g/mol. Its IUPAC name is 2,4,5-trichloro-N-(8-methyl-7,8,9,10-tetrahydronaphtho[1,2-b][1]benzofuran-5-yl)benzenesulfonamide.
| Compound Name | 2,4,5-trichloro-N-(8-methyl-7,8,9,10-tetrahydronaphtho[1,2-b][1]benzofuran-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 25035364 |
| Molecular Formula | C23H18Cl3NO3S |
| Molecular Weight | 494.83 g/mol |
| Exact Mass | 493.01 |
| IUPAC Name | 2,4,5-trichloro-N-(8-methyl-7,8,9,10-tetrahydronaphtho[1,2-b][1]benzofuran-5-yl)benzenesulfonamide |
| SMILES | CC1CCc2oc3c(cc(NS(=O)(=O)c4cc(Cl)c(Cl)cc4Cl)c4ccccc43)c2C1 |
| InChI | InChI=1S/C23H18Cl3NO3S/c1-12-6-7-21-15(8-12)16-9-20(13-4-2-3-5-14(13)23(16)30-21)27-31(28,29)22-11-18(25)17(24)10-19(22)26/h2-5,9-12,27H,6-8H2,1H3 |
| InChIKey | STXQKPYZVDLLAG-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.83 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|