C10H12N4O2S — CID 17375852
1,3-dimethyl-N-pyridin-2-ylpyrazole-4-sulfonamide (PubChem CID 17375852) has the molecular formula C10H12N4O2S and a molecular weight of 252.30 g/mol. Its IUPAC name is 1,3-dimethyl-N-pyridin-2-ylpyrazole-4-sulfonamide.
| Compound Name | 1,3-dimethyl-N-pyridin-2-ylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 17375852 |
| Molecular Formula | C10H12N4O2S |
| Molecular Weight | 252.30 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 1,3-dimethyl-N-pyridin-2-ylpyrazole-4-sulfonamide |
| SMILES | Cc1nn(C)cc1S(=O)(=O)Nc1ccccn1 |
| InChI | InChI=1S/C10H12N4O2S/c1-8-9(7-14(2)12-8)17(15,16)13-10-5-3-4-6-11-10/h3-7H,1-2H3,(H,11,13) |
| InChIKey | ZBYATZMLXYJMGI-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.30 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |