C13H17N3O2S — CID 22773854
N-(4-ethylphenyl)-1,3-dimethylpyrazole-4-sulfonamide (PubChem CID 22773854) has the molecular formula C13H17N3O2S and a molecular weight of 279.37 g/mol. Its IUPAC name is N-(4-ethylphenyl)-1,3-dimethylpyrazole-4-sulfonamide.
| Compound Name | N-(4-ethylphenyl)-1,3-dimethylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 22773854 |
| Molecular Formula | C13H17N3O2S |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | N-(4-ethylphenyl)-1,3-dimethylpyrazole-4-sulfonamide |
| SMILES | CCc1ccc(NS(=O)(=O)c2cn(C)nc2C)cc1 |
| InChI | InChI=1S/C13H17N3O2S/c1-4-11-5-7-12(8-6-11)15-19(17,18)13-9-16(3)14-10(13)2/h5-9,15H,4H2,1-3H3 |
| InChIKey | BPAFRWINCDIDFE-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |