C17H16N2O5S — CID 110676994
N-ethyl-N-(3-methylphenyl)-2,4-dioxo-1H-3,1-benzoxazine-6-sulfonamide (PubChem CID 110676994) has the molecular formula C17H16N2O5S and a molecular weight of 360.39 g/mol. Its IUPAC name is N-ethyl-N-(3-methylphenyl)-2,4-dioxo-1H-3,1-benzoxazine-6-sulfonamide.
| Compound Name | N-ethyl-N-(3-methylphenyl)-2,4-dioxo-1H-3,1-benzoxazine-6-sulfonamide |
|---|---|
| PubChem CID | 110676994 |
| Molecular Formula | C17H16N2O5S |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | N-ethyl-N-(3-methylphenyl)-2,4-dioxo-1H-3,1-benzoxazine-6-sulfonamide |
| SMILES | CCN(c1cccc(C)c1)S(=O)(=O)c1ccc2[nH]c(=O)oc(=O)c2c1 |
| InChI | InChI=1S/C17H16N2O5S/c1-3-19(12-6-4-5-11(2)9-12)25(22,23)13-7-8-15-14(10-13)16(20)24-17(21)18-15/h4-10H,3H2,1-2H3,(H,18,21) |
| InChIKey | HDKDAGYCCJTTLR-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |