C44H54N4 — CID 144692080
1-N,3-N-bis[4-(dimethylamino)phenyl]-1-N,3-N-bis[3-(2-methylbutan-2-yl)phenyl]benzene-1,3-diamine (PubChem CID 144692080) has the molecular formula C44H54N4 and a molecular weight of 638.94 g/mol. Its IUPAC name is 1-N,3-N-bis[4-(dimethylamino)phenyl]-1-N,3-N-bis[3-(2-methylbutan-2-yl)phenyl]benzene-1,3-diamine.
| Compound Name | 1-N,3-N-bis[4-(dimethylamino)phenyl]-1-N,3-N-bis[3-(2-methylbutan-2-yl)phenyl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 144692080 |
| Molecular Formula | C44H54N4 |
| Molecular Weight | 638.94 g/mol |
| Exact Mass | 638.43 |
| IUPAC Name | 1-N,3-N-bis[4-(dimethylamino)phenyl]-1-N,3-N-bis[3-(2-methylbutan-2-yl)phenyl]benzene-1,3-diamine |
| SMILES | CCC(C)(C)c1cccc(N(c2ccc(N(C)C)cc2)c2cccc(N(c3ccc(N(C)C)cc3)c3cccc(C(C)(C)CC)c3)c2)c1 |
| InChI | InChI=1S/C44H54N4/c1-11-43(3,4)33-16-13-18-39(30-33)47(37-26-22-35(23-27-37)45(7)8)41-20-15-21-42(32-41)48(38-28-24-36(25-29-38)46(9)10)40-19-14-17-34(31-40)44(5,6)12-2/h13-32H,11-12H2,1-10H3 |
| InChIKey | HTKDLMXKJTYWMU-UHFFFAOYSA-N |
| XLogP | 12.13 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.94 |
| LogP ≤ 5 | 12.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|