C28H33N — CID 89294487
3-ethenyl-N-[4-(2-methylbutan-2-yl)phenyl]-N-(4-propan-2-ylphenyl)aniline (PubChem CID 89294487) has the molecular formula C28H33N and a molecular weight of 383.58 g/mol. Its IUPAC name is 3-ethenyl-N-[4-(2-methylbutan-2-yl)phenyl]-N-(4-propan-2-ylphenyl)aniline.
| Compound Name | 3-ethenyl-N-[4-(2-methylbutan-2-yl)phenyl]-N-(4-propan-2-ylphenyl)aniline |
|---|---|
| PubChem CID | 89294487 |
| Molecular Formula | C28H33N |
| Molecular Weight | 383.58 g/mol |
| Exact Mass | 383.26 |
| IUPAC Name | 3-ethenyl-N-[4-(2-methylbutan-2-yl)phenyl]-N-(4-propan-2-ylphenyl)aniline |
| SMILES | C=Cc1cccc(N(c2ccc(C(C)C)cc2)c2ccc(C(C)(C)CC)cc2)c1 |
| InChI | InChI=1S/C28H33N/c1-7-22-10-9-11-27(20-22)29(25-16-12-23(13-17-25)21(3)4)26-18-14-24(15-19-26)28(5,6)8-2/h7,9-21H,1,8H2,2-6H3 |
| InChIKey | IPAOAHFVEVYGHZ-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.58 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |