C31H39N — CID 89294997
N-(4-butan-2-ylphenyl)-3-ethenyl-N-[4-(3-methylhexan-3-yl)phenyl]aniline (PubChem CID 89294997) has the molecular formula C31H39N and a molecular weight of 425.66 g/mol. Its IUPAC name is N-(4-butan-2-ylphenyl)-3-ethenyl-N-[4-(3-methylhexan-3-yl)phenyl]aniline.
| Compound Name | N-(4-butan-2-ylphenyl)-3-ethenyl-N-[4-(3-methylhexan-3-yl)phenyl]aniline |
|---|---|
| PubChem CID | 89294997 |
| Molecular Formula | C31H39N |
| Molecular Weight | 425.66 g/mol |
| Exact Mass | 425.31 |
| IUPAC Name | N-(4-butan-2-ylphenyl)-3-ethenyl-N-[4-(3-methylhexan-3-yl)phenyl]aniline |
| SMILES | C=Cc1cccc(N(c2ccc(C(C)CC)cc2)c2ccc(C(C)(CC)CCC)cc2)c1 |
| InChI | InChI=1S/C31H39N/c1-7-22-31(6,10-4)27-16-20-29(21-17-27)32(30-13-11-12-25(9-3)23-30)28-18-14-26(15-19-28)24(5)8-2/h9,11-21,23-24H,3,7-8,10,22H2,1-2,4-6H3 |
| InChIKey | YNOCIKBSKMCGKD-UHFFFAOYSA-N |
| XLogP | 9.78 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.66 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |