C35H47N — CID 89344348
3-ethenyl-N-[4-(3-methylheptan-3-yl)phenyl]-N-[4-(3-methylhexan-3-yl)phenyl]aniline (PubChem CID 89344348) has the molecular formula C35H47N and a molecular weight of 481.77 g/mol. Its IUPAC name is 3-ethenyl-N-[4-(3-methylheptan-3-yl)phenyl]-N-[4-(3-methylhexan-3-yl)phenyl]aniline.
| Compound Name | 3-ethenyl-N-[4-(3-methylheptan-3-yl)phenyl]-N-[4-(3-methylhexan-3-yl)phenyl]aniline |
|---|---|
| PubChem CID | 89344348 |
| Molecular Formula | C35H47N |
| Molecular Weight | 481.77 g/mol |
| Exact Mass | 481.37 |
| IUPAC Name | 3-ethenyl-N-[4-(3-methylheptan-3-yl)phenyl]-N-[4-(3-methylhexan-3-yl)phenyl]aniline |
| SMILES | C=Cc1cccc(N(c2ccc(C(C)(CC)CCC)cc2)c2ccc(C(C)(CC)CCCC)cc2)c1 |
| InChI | InChI=1S/C35H47N/c1-8-13-26-35(7,12-5)30-19-23-32(24-20-30)36(33-16-14-15-28(10-3)27-33)31-21-17-29(18-22-31)34(6,11-4)25-9-2/h10,14-24,27H,3,8-9,11-13,25-26H2,1-2,4-7H3 |
| InChIKey | GSYNTWSRNVLWNQ-UHFFFAOYSA-N |
| XLogP | 11.13 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.77 |
| LogP ≤ 5 | 11.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |