C33H43N — CID 143498666
4-ethenyl-N-[4-(3-methylhexan-3-yl)phenyl]-N-[4-(2-methylpentan-2-yl)phenyl]aniline (PubChem CID 143498666) has the molecular formula C33H43N and a molecular weight of 453.71 g/mol. Its IUPAC name is 4-ethenyl-N-[4-(3-methylhexan-3-yl)phenyl]-N-[4-(2-methylpentan-2-yl)phenyl]aniline.
| Compound Name | 4-ethenyl-N-[4-(3-methylhexan-3-yl)phenyl]-N-[4-(2-methylpentan-2-yl)phenyl]aniline |
|---|---|
| PubChem CID | 143498666 |
| Molecular Formula | C33H43N |
| Molecular Weight | 453.71 g/mol |
| Exact Mass | 453.34 |
| IUPAC Name | 4-ethenyl-N-[4-(3-methylhexan-3-yl)phenyl]-N-[4-(2-methylpentan-2-yl)phenyl]aniline |
| SMILES | C=Cc1ccc(N(c2ccc(C(C)(C)CCC)cc2)c2ccc(C(C)(CC)CCC)cc2)cc1 |
| InChI | InChI=1S/C33H43N/c1-8-24-32(5,6)27-14-20-30(21-15-27)34(29-18-12-26(10-3)13-19-29)31-22-16-28(17-23-31)33(7,11-4)25-9-2/h10,12-23H,3,8-9,11,24-25H2,1-2,4-7H3 |
| InChIKey | QKKBUDCJENVDOQ-UHFFFAOYSA-N |
| XLogP | 10.34 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.71 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |