C44H51NO — CID 71176881
N,N-bis[4-(3-methylhexan-3-yl)phenyl]-4-(4-phenoxyphenyl)aniline (PubChem CID 71176881) has the molecular formula C44H51NO and a molecular weight of 609.90 g/mol. Its IUPAC name is N,N-bis[4-(3-methylhexan-3-yl)phenyl]-4-(4-phenoxyphenyl)aniline.
| Compound Name | N,N-bis[4-(3-methylhexan-3-yl)phenyl]-4-(4-phenoxyphenyl)aniline |
|---|---|
| PubChem CID | 71176881 |
| Molecular Formula | C44H51NO |
| Molecular Weight | 609.90 g/mol |
| Exact Mass | 609.40 |
| IUPAC Name | N,N-bis[4-(3-methylhexan-3-yl)phenyl]-4-(4-phenoxyphenyl)aniline |
| SMILES | CCCC(C)(CC)c1ccc(N(c2ccc(-c3ccc(Oc4ccccc4)cc3)cc2)c2ccc(C(C)(CC)CCC)cc2)cc1 |
| InChI | InChI=1S/C44H51NO/c1-7-32-43(5,9-3)36-20-26-39(27-21-36)45(40-28-22-37(23-29-40)44(6,10-4)33-8-2)38-24-16-34(17-25-38)35-18-30-42(31-19-35)46-41-14-12-11-13-15-41/h11-31H,7-10,32-33H2,1-6H3 |
| InChIKey | GSZVUIYPWGNDBL-UHFFFAOYSA-N |
| XLogP | 13.55 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.90 |
| LogP ≤ 5 | 13.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |