C68H54N2O6S — CID 123519117
4-[3,4-diethoxy-5-[4-(4-phenoxy-N-(4-phenoxyphenyl)anilino)phenyl]thiophen-2-yl]-N,N-bis(4-phenoxyphenyl)aniline (PubChem CID 123519117) has the molecular formula C68H54N2O6S and a molecular weight of 1027.26 g/mol. Its IUPAC name is 4-[3,4-diethoxy-5-[4-(4-phenoxy-N-(4-phenoxyphenyl)anilino)phenyl]thiophen-2-yl]-N,N-bis(4-phenoxyphenyl)aniline.
| Compound Name | 4-[3,4-diethoxy-5-[4-(4-phenoxy-N-(4-phenoxyphenyl)anilino)phenyl]thiophen-2-yl]-N,N-bis(4-phenoxyphenyl)aniline |
|---|---|
| PubChem CID | 123519117 |
| Molecular Formula | C68H54N2O6S |
| Molecular Weight | 1027.26 g/mol |
| Exact Mass | 1026.37 |
| IUPAC Name | 4-[3,4-diethoxy-5-[4-(4-phenoxy-N-(4-phenoxyphenyl)anilino)phenyl]thiophen-2-yl]-N,N-bis(4-phenoxyphenyl)aniline |
| SMILES | CCOc1c(-c2ccc(N(c3ccc(Oc4ccccc4)cc3)c3ccc(Oc4ccccc4)cc3)cc2)sc(-c2ccc(N(c3ccc(Oc4ccccc4)cc3)c3ccc(Oc4ccccc4)cc3)cc2)c1OCC |
| InChI | InChI=1S/C68H54N2O6S/c1-3-71-65-66(72-4-2)68(50-27-31-52(32-28-50)70(55-37-45-63(46-38-55)75-59-21-13-7-14-22-59)56-39-47-64(48-40-56)76-60-23-15-8-16-24-60)77-67(65)49-25-29-51(30-26-49)69(53-33-41-61(42-34-53)73-57-17-9-5-10-18-57)54-35-43-62(44-36-54)74-58-19-11-6-12-20-58/h5-48H,3-4H2,1-2H3 |
| InChIKey | BBNNZDZQTADFSQ-UHFFFAOYSA-N |
| XLogP | 19.99 |
| TPSA | 61.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 77 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1027.26 |
| LogP ≤ 5 | 19.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |