C18H28 — CID 154692080
1-(2-methylbutan-2-yl)-4-(3-methylhex-5-en-3-yl)benzene (PubChem CID 154692080) has the molecular formula C18H28 and a molecular weight of 244.42 g/mol. Its IUPAC name is 1-(2-methylbutan-2-yl)-4-(3-methylhex-5-en-3-yl)benzene.
| Compound Name | 1-(2-methylbutan-2-yl)-4-(3-methylhex-5-en-3-yl)benzene |
|---|---|
| PubChem CID | 154692080 |
| Molecular Formula | C18H28 |
| Molecular Weight | 244.42 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | 1-(2-methylbutan-2-yl)-4-(3-methylhex-5-en-3-yl)benzene |
| SMILES | C=CCC(C)(CC)c1ccc(C(C)(C)CC)cc1 |
| InChI | InChI=1S/C18H28/c1-7-14-18(6,9-3)16-12-10-15(11-13-16)17(4,5)8-2/h7,10-13H,1,8-9,14H2,2-6H3 |
| InChIKey | RLXPMVYKBBPSSE-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.42 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|