C34H61N — CID 150846070
N,N-bis(10,10-dimethylundecyl)-3-ethenylaniline (PubChem CID 150846070) has the molecular formula C34H61N and a molecular weight of 483.87 g/mol. Its IUPAC name is N,N-bis(10,10-dimethylundecyl)-3-ethenylaniline.
| Compound Name | N,N-bis(10,10-dimethylundecyl)-3-ethenylaniline |
|---|---|
| PubChem CID | 150846070 |
| Molecular Formula | C34H61N |
| Molecular Weight | 483.87 g/mol |
| Exact Mass | 483.48 |
| IUPAC Name | N,N-bis(10,10-dimethylundecyl)-3-ethenylaniline |
| SMILES | C=Cc1cccc(N(CCCCCCCCCC(C)(C)C)CCCCCCCCCC(C)(C)C)c1 |
| InChI | InChI=1S/C34H61N/c1-8-31-24-23-25-32(30-31)35(28-21-17-13-9-11-15-19-26-33(2,3)4)29-22-18-14-10-12-16-20-27-34(5,6)7/h8,23-25,30H,1,9-22,26-29H2,2-7H3 |
| InChIKey | KPAGEPYXNCBXJH-UHFFFAOYSA-N |
| XLogP | 11.47 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.87 |
| LogP ≤ 5 | 11.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|