C22H23N — CID 123345777
ethane;3-ethenyl-N,N-diphenylaniline (PubChem CID 123345777) has the molecular formula C22H23N and a molecular weight of 301.43 g/mol. Its IUPAC name is ethane;3-ethenyl-N,N-diphenylaniline.
| Compound Name | ethane;3-ethenyl-N,N-diphenylaniline |
|---|---|
| PubChem CID | 123345777 |
| Molecular Formula | C22H23N |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | ethane;3-ethenyl-N,N-diphenylaniline |
| SMILES | C=Cc1cccc(N(c2ccccc2)c2ccccc2)c1.CC |
| InChI | InChI=1S/C20H17N.C2H6/c1-2-17-10-9-15-20(16-17)21(18-11-5-3-6-12-18)19-13-7-4-8-14-19;1-2/h2-16H,1H2;1-2H3 |
| InChIKey | GUFDITIETCCDGS-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |