C78H110N2 — CID 89344519
2-N,7-N-bis(4-butan-2-ylphenyl)-2-N-[4-(3,4-diethylheptan-4-yl)phenyl]-7-N-[4-(3-methylpentan-3-yl)phenyl]-9,9-dioctylfluorene-2,7-diamine (PubChem CID 89344519) has the molecular formula C78H110N2 and a molecular weight of 1075.75 g/mol. Its IUPAC name is 2-N,7-N-bis(4-butan-2-ylphenyl)-2-N-[4-(3,4-diethylheptan-4-yl)phenyl]-7-N-[4-(3-methylpentan-3-yl)phenyl]-9,9-dioctylfluorene-2,7-diamine.
| Compound Name | 2-N,7-N-bis(4-butan-2-ylphenyl)-2-N-[4-(3,4-diethylheptan-4-yl)phenyl]-7-N-[4-(3-methylpentan-3-yl)phenyl]-9,9-dioctylfluorene-2,7-diamine |
|---|---|
| PubChem CID | 89344519 |
| Molecular Formula | C78H110N2 |
| Molecular Weight | 1075.75 g/mol |
| Exact Mass | 1074.87 |
| IUPAC Name | 2-N,7-N-bis(4-butan-2-ylphenyl)-2-N-[4-(3,4-diethylheptan-4-yl)phenyl]-7-N-[4-(3-methylpentan-3-yl)phenyl]-9,9-dioctylfluorene-2,7-diamine |
| SMILES | CCCCCCCCC1(CCCCCCCC)c2cc(N(c3ccc(C(C)CC)cc3)c3ccc(C(C)(CC)CC)cc3)ccc2-c2ccc(N(c3ccc(C(C)CC)cc3)c3ccc(C(CC)(CCC)C(CC)CC)cc3)cc21 |
| InChI | InChI=1S/C78H110N2/c1-14-24-26-28-30-32-55-78(56-33-31-29-27-25-15-2)74-57-70(79(66-42-34-61(35-43-66)59(11)17-4)68-46-38-64(39-47-68)76(13,21-8)22-9)50-52-72(74)73-53-51-71(58-75(73)78)80(67-44-36-62(37-45-67)60(12)18-5)69-48-40-65(41-49-69)77(23-10,54-16-3)63(19-6)20-7/h34-53,57-60,63H,14-33,54-56H2,1-13H3 |
| InChIKey | YSZMIOSDDTZJSQ-UHFFFAOYSA-N |
| XLogP | 25.38 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1075.75 |
| LogP ≤ 5 | 25.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|