C76H106N2 — CID 143635456
2-N,7-N-bis(4-butan-2-ylphenyl)-2-N-[4-(4-ethyl-3-methylhexan-3-yl)phenyl]-7-N-[4-(2-methylpentan-2-yl)phenyl]-9,9-dioctylfluorene-2,7-diamine (PubChem CID 143635456) has the molecular formula C76H106N2 and a molecular weight of 1047.70 g/mol. Its IUPAC name is 2-N,7-N-bis(4-butan-2-ylphenyl)-2-N-[4-(4-ethyl-3-methylhexan-3-yl)phenyl]-7-N-[4-(2-methylpentan-2-yl)phenyl]-9,9-dioctylfluorene-2,7-diamine.
| Compound Name | 2-N,7-N-bis(4-butan-2-ylphenyl)-2-N-[4-(4-ethyl-3-methylhexan-3-yl)phenyl]-7-N-[4-(2-methylpentan-2-yl)phenyl]-9,9-dioctylfluorene-2,7-diamine |
|---|---|
| PubChem CID | 143635456 |
| Molecular Formula | C76H106N2 |
| Molecular Weight | 1047.70 g/mol |
| Exact Mass | 1046.84 |
| IUPAC Name | 2-N,7-N-bis(4-butan-2-ylphenyl)-2-N-[4-(4-ethyl-3-methylhexan-3-yl)phenyl]-7-N-[4-(2-methylpentan-2-yl)phenyl]-9,9-dioctylfluorene-2,7-diamine |
| SMILES | CCCCCCCCC1(CCCCCCCC)c2cc(N(c3ccc(C(C)CC)cc3)c3ccc(C(C)(C)CCC)cc3)ccc2-c2ccc(N(c3ccc(C(C)CC)cc3)c3ccc(C(C)(CC)C(CC)CC)cc3)cc21 |
| InChI | InChI=1S/C76H106N2/c1-14-22-24-26-28-30-53-76(54-31-29-27-25-23-15-2)72-55-68(77(64-40-32-59(33-41-64)57(9)17-4)66-44-36-62(37-45-66)74(11,12)52-16-3)48-50-70(72)71-51-49-69(56-73(71)76)78(65-42-34-60(35-43-65)58(10)18-5)67-46-38-63(39-47-67)75(13,21-8)61(19-6)20-7/h32-51,55-58,61H,14-31,52-54H2,1-13H3 |
| InChIKey | IVCOPMUVEDBXDP-UHFFFAOYSA-N |
| XLogP | 24.60 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1047.70 |
| LogP ≤ 5 | 24.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|